Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
L(-)-Glutathione, oxidized hydrate, 95%
CAS: 27025-41-8 Molecular Formula: C20H32N6O12S2 Molecular Weight (g/mol): 612.63 MDL Number: MFCD00150701 InChI Key: YPZRWBKMTBYPTK-IOKZUGQQNA-N Synonym: oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized PubChem CID: 65359 ChEBI: CHEBI:17858 IUPAC Name: (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid SMILES: N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O
| PubChem CID | 65359 |
|---|---|
| CAS | 27025-41-8 |
| Molecular Weight (g/mol) | 612.63 |
| ChEBI | CHEBI:17858 |
| MDL Number | MFCD00150701 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O |
| Synonym | oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| InChI Key | YPZRWBKMTBYPTK-IOKZUGQQNA-N |
| Molecular Formula | C20H32N6O12S2 |
4-Methylmorpholine, 99%
CAS: 109-02-4 Molecular Formula: C5H11NO Molecular Weight (g/mol): 101.15 MDL Number: MFCD00006175 InChI Key: SJRJJKPEHAURKC-UHFFFAOYSA-N Synonym: n-methylmorpholine,morpholine, 4-methyl,methylmorpholine,1-methylmorpholine,morpholine, n-methyl,4-methylmorfolin,4-methylmorpholin,n-methyl morpholine,4-methylmorfolin czech,n-methylmorpholin PubChem CID: 7972 IUPAC Name: 4-methylmorpholine SMILES: CN1CCOCC1
| PubChem CID | 7972 |
|---|---|
| CAS | 109-02-4 |
| Molecular Weight (g/mol) | 101.15 |
| MDL Number | MFCD00006175 |
| SMILES | CN1CCOCC1 |
| Synonym | n-methylmorpholine,morpholine, 4-methyl,methylmorpholine,1-methylmorpholine,morpholine, n-methyl,4-methylmorfolin,4-methylmorpholin,n-methyl morpholine,4-methylmorfolin czech,n-methylmorpholin |
| IUPAC Name | 4-methylmorpholine |
| InChI Key | SJRJJKPEHAURKC-UHFFFAOYSA-N |
| Molecular Formula | C5H11NO |
Acriflavine hydrochloride, Thermo Scientific Chemicals
CAS: 8063-24-9 Molecular Formula: C27H27Cl3N6 Molecular Weight (g/mol): 541.91 MDL Number: MFCD00069039 InChI Key: MKLTXAHQKDVBLY-UHFFFAOYSA-N Synonym: 3,6-Diamino-10-methylacridinium chloride hydrochloride; Euflavine IUPAC Name: 3,6-diamino-10-methylacridin-10-ium acridine-3,6-diamine dihydrochloride chloride SMILES: Cl.Cl.[Cl-].NC1=CC2=NC3=CC(N)=CC=C3C=C2C=C1.C[N+]1=C2C=C(N)C=CC2=CC2=CC=C(N)C=C12
| CAS | 8063-24-9 |
|---|---|
| Molecular Weight (g/mol) | 541.91 |
| MDL Number | MFCD00069039 |
| SMILES | Cl.Cl.[Cl-].NC1=CC2=NC3=CC(N)=CC=C3C=C2C=C1.C[N+]1=C2C=C(N)C=CC2=CC2=CC=C(N)C=C12 |
| Synonym | 3,6-Diamino-10-methylacridinium chloride hydrochloride; Euflavine |
| IUPAC Name | 3,6-diamino-10-methylacridin-10-ium acridine-3,6-diamine dihydrochloride chloride |
| InChI Key | MKLTXAHQKDVBLY-UHFFFAOYSA-N |
| Molecular Formula | C27H27Cl3N6 |
2,2,2-Trifluoroethanol, 99.8%, extra pure
CAS: 75-89-8 Molecular Formula: C2H3F3O Molecular Weight (g/mol): 100.04 MDL Number: MFCD00004672 InChI Key: RHQDFWAXVIIEBN-UHFFFAOYSA-N Synonym: trifluoroethanol,ethanol, 2,2,2-trifluoro,2,2,2-trifluoroethan-1-ol,fluorinol 85,2,2,2-trifluoroethyl alcohol,trifluoroethyl alcohol,trifluoro ethanol,tfe,perfluoro-1,1-dihydroethanol,tfetoh PubChem CID: 6409 ChEBI: CHEBI:42330 IUPAC Name: 2,2,2-trifluoroethanol SMILES: OCC(F)(F)F
| PubChem CID | 6409 |
|---|---|
| CAS | 75-89-8 |
| Molecular Weight (g/mol) | 100.04 |
| ChEBI | CHEBI:42330 |
| MDL Number | MFCD00004672 |
| SMILES | OCC(F)(F)F |
| Synonym | trifluoroethanol,ethanol, 2,2,2-trifluoro,2,2,2-trifluoroethan-1-ol,fluorinol 85,2,2,2-trifluoroethyl alcohol,trifluoroethyl alcohol,trifluoro ethanol,tfe,perfluoro-1,1-dihydroethanol,tfetoh |
| IUPAC Name | 2,2,2-trifluoroethanol |
| InChI Key | RHQDFWAXVIIEBN-UHFFFAOYSA-N |
| Molecular Formula | C2H3F3O |
Poly(methyl methacrylate), beads, average M.W. 35,000
CAS: 9011-14-7 Molecular Formula: (C5H8O2)n Molecular Weight (g/mol): NaN MDL Number: MFCD00134349 InChI Key: PMAMJWJDBDSDHV-UHFFFAOYSA-N Synonym: Methyl methacrylate, polymerized,PMMA IUPAC Name: 1-methoxy-2-methyl-1-oxopropan-2-yl SMILES: COC(=O)C(C)(-*)C-*
| CAS | 9011-14-7 |
|---|---|
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00134349 |
| SMILES | COC(=O)C(C)(-*)C-* |
| Synonym | Methyl methacrylate, polymerized,PMMA |
| IUPAC Name | 1-methoxy-2-methyl-1-oxopropan-2-yl |
| InChI Key | PMAMJWJDBDSDHV-UHFFFAOYSA-N |
| Molecular Formula | (C5H8O2)n |
Acetamide, 99%
CAS: 60-35-5 Molecular Formula: C2H5NO Molecular Weight (g/mol): 59.068 MDL Number: MFCD00008023 InChI Key: DLFVBJFMPXGRIB-UHFFFAOYSA-N Synonym: ethanamide,acetic acid amide,methanecarboxamide,acetimidic acid,amide c2,ethanimidic acid,acetamid,amid kyseliny octove,caswell no. 003h,acetimidic acid van PubChem CID: 178 ChEBI: CHEBI:49028 IUPAC Name: acetamide SMILES: CC(=O)N
| PubChem CID | 178 |
|---|---|
| CAS | 60-35-5 |
| Molecular Weight (g/mol) | 59.068 |
| ChEBI | CHEBI:49028 |
| MDL Number | MFCD00008023 |
| SMILES | CC(=O)N |
| Synonym | ethanamide,acetic acid amide,methanecarboxamide,acetimidic acid,amide c2,ethanimidic acid,acetamid,amid kyseliny octove,caswell no. 003h,acetimidic acid van |
| IUPAC Name | acetamide |
| InChI Key | DLFVBJFMPXGRIB-UHFFFAOYSA-N |
| Molecular Formula | C2H5NO |
Adenosine 5'-monophosphate, 99%
CAS: 61-19-8 Molecular Formula: C10H14N5O7P Molecular Weight (g/mol): 347.22 MDL Number: MFCD00005750 InChI Key: UDMBCSSLTHHNCD-YPLCUDRINA-N Synonym: adenosine 5'-monophosphate,5'-adenylic acid,adenosine monophosphate,adenosine phosphate,adenylic acid,adenylate,phosphaden,5'-amp,adenosine 5'-phosphate,phosphentaside PubChem CID: 6083 ChEBI: CHEBI:16027 IUPAC Name: [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate SMILES: NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1
| PubChem CID | 6083 |
|---|---|
| CAS | 61-19-8 |
| Molecular Weight (g/mol) | 347.22 |
| ChEBI | CHEBI:16027 |
| MDL Number | MFCD00005750 |
| SMILES | NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| Synonym | adenosine 5'-monophosphate,5'-adenylic acid,adenosine monophosphate,adenosine phosphate,adenylic acid,adenylate,phosphaden,5'-amp,adenosine 5'-phosphate,phosphentaside |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChI Key | UDMBCSSLTHHNCD-YPLCUDRINA-N |
| Molecular Formula | C10H14N5O7P |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, disodium salt dihydrate, 99+%, for analysis
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.9100g/mL |
| PubChem CID | 2723671 |
| Name Note | 40 wt.% solution in methanol |
| Percent Purity | ≥40% |
| Fieser | 05,645; 11,500 |
| Formula Weight | 259.46 |
| Melting Point | -98.0°C |
| Boiling Point | 65.0°C |
| Color | Colorless to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Tetrabutylammonium hydroxide |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove conta |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Toxic in contact with skin. Toxic if swallowed. Causes severe skin burns and eye damage. Toxic if inhaled. Causes damage to organs. Highly flammable liquid and vapor. |
| Solubility Information | Solubility in water: soluble |
| Packaging | Glass bottle |
| Flash Point | 12°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04, II, 634 |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.91 |
Polyvinyl alcohol, 98-99% hydrolyzed, medium molecular weight
CAS: 9002-89-5 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 44.05 MDL Number: MFCD00081922 InChI Key: IMROMDMJAWUWLK-UHFFFAOYSA-N Synonym: vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval PubChem CID: 11199 IUPAC Name: ethenol SMILES: OC(-*)C-*
| PubChem CID | 11199 |
|---|---|
| CAS | 9002-89-5 |
| Molecular Weight (g/mol) | 44.05 |
| MDL Number | MFCD00081922 |
| SMILES | OC(-*)C-* |
| Synonym | vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval |
| IUPAC Name | ethenol |
| InChI Key | IMROMDMJAWUWLK-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Diethylene glycol, 99%, extra pure
CAS: 111-46-6 Molecular Formula: C4H10O3 Molecular Weight (g/mol): 106.12 MDL Number: MFCD00002882 InChI Key: MTHSVFCYNBDYFN-UHFFFAOYSA-N Synonym: diethylene glycol,2,2'-oxydiethanol,diglycol,diethylenglykol,2-hydroxyethyl ether,bis 2-hydroxyethyl ether,ethanol, 2,2'-oxybis,2,2'-oxybisethanol,2-2-hydroxyethoxy ethanol,digol PubChem CID: 8117 ChEBI: CHEBI:46807 SMILES: OCCOCCO
| PubChem CID | 8117 |
|---|---|
| CAS | 111-46-6 |
| Molecular Weight (g/mol) | 106.12 |
| ChEBI | CHEBI:46807 |
| MDL Number | MFCD00002882 |
| SMILES | OCCOCCO |
| Synonym | diethylene glycol,2,2'-oxydiethanol,diglycol,diethylenglykol,2-hydroxyethyl ether,bis 2-hydroxyethyl ether,ethanol, 2,2'-oxybis,2,2'-oxybisethanol,2-2-hydroxyethoxy ethanol,digol |
| InChI Key | MTHSVFCYNBDYFN-UHFFFAOYSA-N |
| Molecular Formula | C4H10O3 |
Benzophenone, 99+%, pure
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:41308 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
(±)-1,3-Butanediol, 99%, extra pure
CAS: 107-88-0 Molecular Formula: C4H10O2 Molecular Weight (g/mol): 90.12 MDL Number: MFCD00004554 InChI Key: PUPZLCDOIYMWBV-UHFFFAOYSA-N Synonym: 1,3-butanediol,1,3-butylene glycol,1,3-dihydroxybutane,methyltrimethylene glycol,1,3-butandiol,1-methyl-1,3-propanediol,beta-butylene glycol,1,3 butylene glycol,1,3-butylenglykol,rs-1,3-butandiol PubChem CID: 7896 ChEBI: CHEBI:52683 IUPAC Name: butane-1,3-diol SMILES: CC(CCO)O
| PubChem CID | 7896 |
|---|---|
| CAS | 107-88-0 |
| Molecular Weight (g/mol) | 90.12 |
| ChEBI | CHEBI:52683 |
| MDL Number | MFCD00004554 |
| SMILES | CC(CCO)O |
| Synonym | 1,3-butanediol,1,3-butylene glycol,1,3-dihydroxybutane,methyltrimethylene glycol,1,3-butandiol,1-methyl-1,3-propanediol,beta-butylene glycol,1,3 butylene glycol,1,3-butylenglykol,rs-1,3-butandiol |
| IUPAC Name | butane-1,3-diol |
| InChI Key | PUPZLCDOIYMWBV-UHFFFAOYSA-N |
| Molecular Formula | C4H10O2 |
Cumyl hydroperoxide, tech. 80%
CAS: 80-15-9 Molecular Formula: C9H12O2 Molecular Weight (g/mol): 152.19 MDL Number: MFCD00002129 InChI Key: YQHLDYVWEZKEOX-UHFFFAOYSA-N Synonym: cumene hydroperoxide,cumyl hydroperoxide,hydroperoxide, 1-methyl-1-phenylethyl,cumenyl hydroperoxide,alpha,alpha-dimethylbenzyl hydroperoxide,cumolhydroperoxid,7-cumyl hydroperoxide,cumolhydroperoxide,cument hydroperoxide,hydroperoxyde de cumene PubChem CID: 6629 ChEBI: CHEBI:78673 IUPAC Name: 2-hydroperoxypropan-2-ylbenzene SMILES: CC(C)(OO)C1=CC=CC=C1
| PubChem CID | 6629 |
|---|---|
| CAS | 80-15-9 |
| Molecular Weight (g/mol) | 152.19 |
| ChEBI | CHEBI:78673 |
| MDL Number | MFCD00002129 |
| SMILES | CC(C)(OO)C1=CC=CC=C1 |
| Synonym | cumene hydroperoxide,cumyl hydroperoxide,hydroperoxide, 1-methyl-1-phenylethyl,cumenyl hydroperoxide,alpha,alpha-dimethylbenzyl hydroperoxide,cumolhydroperoxid,7-cumyl hydroperoxide,cumolhydroperoxide,cument hydroperoxide,hydroperoxyde de cumene |
| IUPAC Name | 2-hydroperoxypropan-2-ylbenzene |
| InChI Key | YQHLDYVWEZKEOX-UHFFFAOYSA-N |
| Molecular Formula | C9H12O2 |
Gluconic acid, sodium salt, 98%
CAS: 527-07-1 Molecular Formula: C6H11NaO7 Molecular Weight (g/mol): 218.137 MDL Number: MFCD00064210 InChI Key: UPMFZISCCZSDND-JJKGCWMISA-M Synonym: sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t PubChem CID: 23672301 ChEBI: CHEBI:84997 IUPAC Name: sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+]
| PubChem CID | 23672301 |
|---|---|
| CAS | 527-07-1 |
| Molecular Weight (g/mol) | 218.137 |
| ChEBI | CHEBI:84997 |
| MDL Number | MFCD00064210 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+] |
| Synonym | sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t |
| IUPAC Name | sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | UPMFZISCCZSDND-JJKGCWMISA-M |
| Molecular Formula | C6H11NaO7 |